C23H17FN4O6S2 — CID 18862795
(1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 18862795) has the molecular formula C23H17FN4O6S2 and a molecular weight of 528.54 g/mol. Its IUPAC name is (1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 18862795 |
| Molecular Formula | C23H17FN4O6S2 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | (1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | NC(=O)N1C(=O)[C@@H]2[C@H](c3ccccc3O)c3sc(=O)n(CC(=O)Nc4ccc(F)cc4)c3S[C@@H]2C1=O |
| InChI | InChI=1S/C23H17FN4O6S2/c24-10-5-7-11(8-6-10)26-14(30)9-27-21-18(36-23(27)34)15(12-3-1-2-4-13(12)29)16-17(35-21)20(32)28(19(16)31)22(25)33/h1-8,15-17,29H,9H2,(H2,25,33)(H,26,30)/t15-,16+,17-/m0/s1 |
| InChIKey | ZNIYLVHKSBMXLX-BBWFWOEESA-N |
| XLogP | 2.06 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|