C29H22FN3O5S2 — CID 18862075
N-(4-fluorophenyl)-2-[(1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 18862075) has the molecular formula C29H22FN3O5S2 and a molecular weight of 575.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 18862075 |
| Molecular Formula | C29H22FN3O5S2 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](c4ccccc4O)c4sc(=O)n(CC(=O)Nc5ccc(F)cc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H22FN3O5S2/c1-15-6-12-18(13-7-15)33-26(36)23-22(19-4-2-3-5-20(19)34)25-28(39-24(23)27(33)37)32(29(38)40-25)14-21(35)31-17-10-8-16(30)9-11-17/h2-13,22-24,34H,14H2,1H3,(H,31,35)/t22-,23+,24-/m0/s1 |
| InChIKey | NUMUPEXFSZQKLI-VXNXHJTFSA-N |
| XLogP | 4.50 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|