C29H21Cl2N3O4S2 — CID 16635742
2-[(8S)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 16635742) has the molecular formula C29H21Cl2N3O4S2 and a molecular weight of 610.54 g/mol. Its IUPAC name is 2-[(8S)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16635742 |
| Molecular Formula | C29H21Cl2N3O4S2 |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 2-[(8S)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@H](c2cccc(Cl)c2Cl)C2C(=O)N(c4ccccc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C29H21Cl2N3O4S2/c1-15-10-12-16(13-11-15)32-20(35)14-33-28-25(40-29(33)38)21(18-8-5-9-19(30)23(18)31)22-24(39-28)27(37)34(26(22)36)17-6-3-2-4-7-17/h2-13,21-22,24H,14H2,1H3,(H,32,35)/t21-,22?,24?/m1/s1 |
| InChIKey | GEBDUVSSJYCOLS-ZLHNRXBCSA-N |
| XLogP | 5.96 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|