C34H29N3O9S2 — CID 18862459
ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862459) has the molecular formula C34H29N3O9S2 and a molecular weight of 687.75 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862459 |
| Molecular Formula | C34H29N3O9S2 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2O)[C@H]2C(=O)N(c4ccc(C(=O)OCC)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C34H29N3O9S2/c1-3-45-32(42)18-9-13-20(14-10-18)35-24(39)17-36-31-28(48-34(36)44)25(22-7-5-6-8-23(22)38)26-27(47-31)30(41)37(29(26)40)21-15-11-19(12-16-21)33(43)46-4-2/h5-16,25-27,38H,3-4,17H2,1-2H3,(H,35,39)/t25-,26+,27-/m0/s1 |
| InChIKey | PQZBLDQTHDOYJX-VJGNERBWSA-N |
| XLogP | 4.40 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|