C32H26BrN3O7S2 — CID 19247563
ethyl 4-[[2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 19247563) has the molecular formula C32H26BrN3O7S2 and a molecular weight of 708.61 g/mol. Its IUPAC name is ethyl 4-[[2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19247563 |
| Molecular Formula | C32H26BrN3O7S2 |
| Molecular Weight | 708.61 g/mol |
| Exact Mass | 707.04 |
| IUPAC Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2OC)[C@@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@@H]2S3)cc1 |
| InChI | InChI=1S/C32H26BrN3O7S2/c1-3-43-31(40)17-8-12-19(13-9-17)34-23(37)16-35-30-27(45-32(35)41)24(21-6-4-5-7-22(21)42-2)25-26(44-30)29(39)36(28(25)38)20-14-10-18(33)11-15-20/h4-15,24-26H,3,16H2,1-2H3,(H,34,37)/t24-,25-,26+/m0/s1 |
| InChIKey | ZROGXXBZCDEQGR-KKUQBAQOSA-N |
| XLogP | 5.29 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|