C21H16N4O5S3 — CID 21227000
4-(2-anilino-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 21227000) has the molecular formula C21H16N4O5S3 and a molecular weight of 500.58 g/mol. Its IUPAC name is 4-(2-anilino-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | 4-(2-anilino-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 21227000 |
| Molecular Formula | C21H16N4O5S3 |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 4-(2-anilino-2-oxoethyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | NC(=O)N1C(=O)C2Sc3c(sc(=O)n3CC(=O)Nc3ccccc3)C(c3cccs3)C2C1=O |
| InChI | InChI=1S/C21H16N4O5S3/c22-20(29)25-17(27)14-13(11-7-4-8-31-11)16-19(32-15(14)18(25)28)24(21(30)33-16)9-12(26)23-10-5-2-1-3-6-10/h1-8,13-15H,9H2,(H2,22,29)(H,23,26) |
| InChIKey | BTWGMFIDATXKDC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|