C20H15N3O4S3 — CID 21227120
N-phenyl-2-(5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetamide (PubChem CID 21227120) has the molecular formula C20H15N3O4S3 and a molecular weight of 457.56 g/mol. Its IUPAC name is N-phenyl-2-(5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetamide.
| Compound Name | N-phenyl-2-(5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetamide |
|---|---|
| PubChem CID | 21227120 |
| Molecular Formula | C20H15N3O4S3 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | N-phenyl-2-(5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1cccs1)C1C(=O)NC(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C20H15N3O4S3/c24-12(21-10-5-2-1-3-6-10)9-23-19-16(30-20(23)27)13(11-7-4-8-28-11)14-15(29-19)18(26)22-17(14)25/h1-8,13-15H,9H2,(H,21,24)(H,22,25,26) |
| InChIKey | SONFRAYLFVWELM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|