C18H17N3O5S3 — CID 21227212
4-(2-morpholin-4-yl-2-oxoethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 21227212) has the molecular formula C18H17N3O5S3 and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-2-oxoethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 4-(2-morpholin-4-yl-2-oxoethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 21227212 |
| Molecular Formula | C18H17N3O5S3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 4-(2-morpholin-4-yl-2-oxoethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1NC(=O)C2C1Sc1c(sc(=O)n1CC(=O)N1CCOCC1)C2c1cccs1 |
| InChI | InChI=1S/C18H17N3O5S3/c22-10(20-3-5-26-6-4-20)8-21-17-14(29-18(21)25)11(9-2-1-7-27-9)12-13(28-17)16(24)19-15(12)23/h1-2,7,11-13H,3-6,8H2,(H,19,23,24) |
| InChIKey | WJODFVAVRLETIO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|