C26H22F3N3O4S3 — CID 19249480
(1R,8R,9R)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19249480) has the molecular formula C26H22F3N3O4S3 and a molecular weight of 593.67 g/mol. Its IUPAC name is (1R,8R,9R)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19249480 |
| Molecular Formula | C26H22F3N3O4S3 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | (1R,8R,9R)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]1S2)N1CCCCC1 |
| InChI | InChI=1S/C26H22F3N3O4S3/c27-26(28,29)14-7-2-3-8-15(14)32-22(34)19-18(16-9-6-12-37-16)21-24(38-20(19)23(32)35)31(25(36)39-21)13-17(33)30-10-4-1-5-11-30/h2-3,6-9,12,18-20H,1,4-5,10-11,13H2/t18-,19-,20+/m0/s1 |
| InChIKey | LSMGLCDJUKUYGM-SLFFLAALSA-N |
| XLogP | 4.80 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|