C28H23F4N3O4S2 — CID 19249479
(1R,8R,9R)-8-(4-fluorophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19249479) has the molecular formula C28H23F4N3O4S2 and a molecular weight of 605.64 g/mol. Its IUPAC name is (1R,8R,9R)-8-(4-fluorophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-(4-fluorophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19249479 |
| Molecular Formula | C28H23F4N3O4S2 |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | (1R,8R,9R)-8-(4-fluorophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccc(F)cc1)[C@@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]1S2)N1CCCCC1 |
| InChI | InChI=1S/C28H23F4N3O4S2/c29-16-10-8-15(9-11-16)20-21-22(25(38)35(24(21)37)18-7-3-2-6-17(18)28(30,31)32)40-26-23(20)41-27(39)34(26)14-19(36)33-12-4-1-5-13-33/h2-3,6-11,20-22H,1,4-5,12-14H2/t20-,21-,22+/m0/s1 |
| InChIKey | TZVKEJOUTONTPB-FDFHNCONSA-N |
| XLogP | 4.88 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|