C26H21F3N4O5S2 — CID 16636098
(8S)-4-(2-morpholin-4-yl-2-oxoethyl)-8-pyridin-3-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16636098) has the molecular formula C26H21F3N4O5S2 and a molecular weight of 590.61 g/mol. Its IUPAC name is (8S)-4-(2-morpholin-4-yl-2-oxoethyl)-8-pyridin-3-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-4-(2-morpholin-4-yl-2-oxoethyl)-8-pyridin-3-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16636098 |
| Molecular Formula | C26H21F3N4O5S2 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | (8S)-4-(2-morpholin-4-yl-2-oxoethyl)-8-pyridin-3-yl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccnc1)C1C(=O)N(c3ccccc3C(F)(F)F)C(=O)C1S2)N1CCOCC1 |
| InChI | InChI=1S/C26H21F3N4O5S2/c27-26(28,29)15-5-1-2-6-16(15)33-22(35)19-18(14-4-3-7-30-12-14)21-24(39-20(19)23(33)36)32(25(37)40-21)13-17(34)31-8-10-38-11-9-31/h1-7,12,18-20H,8-11,13H2/t18-,19?,20?/m1/s1 |
| InChIKey | VHKQQMUTGPTZEG-XEVCZEQESA-N |
| XLogP | 2.98 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|