C27H22F3N3O5S2 — CID 19249488
(1R,8R,9R)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19249488) has the molecular formula C27H22F3N3O5S2 and a molecular weight of 589.62 g/mol. Its IUPAC name is (1R,8R,9R)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19249488 |
| Molecular Formula | C27H22F3N3O5S2 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | (1R,8R,9R)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]1S2)N1CCOCC1 |
| InChI | InChI=1S/C27H22F3N3O5S2/c28-27(29,30)16-8-4-5-9-17(16)33-23(35)20-19(15-6-2-1-3-7-15)22-25(39-21(20)24(33)36)32(26(37)40-22)14-18(34)31-10-12-38-13-11-31/h1-9,19-21H,10-14H2/t19-,20-,21+/m0/s1 |
| InChIKey | GGNRZPMPEXLTBL-PCCBWWKXSA-N |
| XLogP | 3.58 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|