C30H29F3N4O4S2 — CID 16636092
(8S)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16636092) has the molecular formula C30H29F3N4O4S2 and a molecular weight of 630.71 g/mol. Its IUPAC name is (8S)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16636092 |
| Molecular Formula | C30H29F3N4O4S2 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | (8S)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CN(C)c1ccc([C@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1 |
| InChI | InChI=1S/C30H29F3N4O4S2/c1-34(2)18-12-10-17(11-13-18)22-23-24(27(40)37(26(23)39)20-9-5-4-8-19(20)30(31,32)33)42-28-25(22)43-29(41)36(28)16-21(38)35-14-6-3-7-15-35/h4-5,8-13,22-24H,3,6-7,14-16H2,1-2H3/t22-,23?,24?/m1/s1 |
| InChIKey | CGUKDMACEMFWDU-ZKMFCFPVSA-N |
| XLogP | 4.80 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|