C29H28F3N3O5S2 — CID 43848636
ethyl 2-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 43848636) has the molecular formula C29H28F3N3O5S2 and a molecular weight of 619.69 g/mol. Its IUPAC name is ethyl 2-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 43848636 |
| Molecular Formula | C29H28F3N3O5S2 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | ethyl 2-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)C(c1ccc(N(CC)CC)cc1)C1C(=O)N(c3ccccc3C(F)(F)F)C(=O)C1S2 |
| InChI | InChI=1S/C29H28F3N3O5S2/c1-4-33(5-2)17-13-11-16(12-14-17)21-22-23(41-27-24(21)42-28(39)34(27)15-20(36)40-6-3)26(38)35(25(22)37)19-10-8-7-9-18(19)29(30,31)32/h7-14,21-23H,4-6,15H2,1-3H3 |
| InChIKey | NJNKIRMPFSTUSV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|