C25H17Cl2F3N2O5S2 — CID 19249586
ethyl 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 19249586) has the molecular formula C25H17Cl2F3N2O5S2 and a molecular weight of 617.45 g/mol. Its IUPAC name is ethyl 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 19249586 |
| Molecular Formula | C25H17Cl2F3N2O5S2 |
| Molecular Weight | 617.45 g/mol |
| Exact Mass | 615.99 |
| IUPAC Name | ethyl 2-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1cccc(Cl)c1Cl)[C@@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C25H17Cl2F3N2O5S2/c1-2-37-15(33)10-31-23-20(39-24(31)36)16(11-6-5-8-13(26)18(11)27)17-19(38-23)22(35)32(21(17)34)14-9-4-3-7-12(14)25(28,29)30/h3-9,16-17,19H,2,10H2,1H3/t16-,17-,19+/m0/s1 |
| InChIKey | PHUMTXGRGCBTGB-JENIJYKNSA-N |
| XLogP | 5.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|