C35H25Cl2N3O6S2 — CID 19248251
ethyl 4-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248251) has the molecular formula C35H25Cl2N3O6S2 and a molecular weight of 718.64 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248251 |
| Molecular Formula | C35H25Cl2N3O6S2 |
| Molecular Weight | 718.64 g/mol |
| Exact Mass | 717.06 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-(2,3-dichlorophenyl)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4cccc(Cl)c4Cl)c4sc(=O)n(CC(=O)Nc5cccc6ccccc56)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C35H25Cl2N3O6S2/c1-2-46-34(44)19-13-15-20(16-14-19)40-31(42)27-26(22-10-6-11-23(36)28(22)37)30-33(47-29(27)32(40)43)39(35(45)48-30)17-25(41)38-24-12-5-8-18-7-3-4-9-21(18)24/h3-16,26-27,29H,2,17H2,1H3,(H,38,41)/t26-,27-,29+/m0/s1 |
| InChIKey | LMWNWNFHZFTODP-HPUNYJORSA-N |
| XLogP | 6.98 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|