C34H26N4O6S2 — CID 16635143
ethyl 4-[(8S)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635143) has the molecular formula C34H26N4O6S2 and a molecular weight of 650.74 g/mol. Its IUPAC name is ethyl 4-[(8S)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635143 |
| Molecular Formula | C34H26N4O6S2 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | ethyl 4-[(8S)-4-[2-(naphthalen-1-ylamino)-2-oxoethyl]-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4cccc5ccccc45)[C@H](c4cccnc4)C3C2=O)cc1 |
| InChI | InChI=1S/C34H26N4O6S2/c1-2-44-33(42)20-12-14-22(15-13-20)38-30(40)27-26(21-9-6-16-35-17-21)29-32(45-28(27)31(38)41)37(34(43)46-29)18-25(39)36-24-11-5-8-19-7-3-4-10-23(19)24/h3-17,26-28H,2,18H2,1H3,(H,36,39)/t26-,27?,28?/m1/s1 |
| InChIKey | UKUWUVXYGIOROQ-VOYUOQKBSA-N |
| XLogP | 5.07 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|