C31H23F3N4O6S2 — CID 43846165
ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43846165) has the molecular formula C31H23F3N4O6S2 and a molecular weight of 668.68 g/mol. Its IUPAC name is ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43846165 |
| Molecular Formula | C31H23F3N4O6S2 |
| Molecular Weight | 668.68 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4cccc(C(F)(F)F)c4)[C@@H](c4cccnc4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H23F3N4O6S2/c1-2-44-29(42)16-8-10-20(11-9-16)38-26(40)23-22(17-5-4-12-35-14-17)25-28(45-24(23)27(38)41)37(30(43)46-25)15-21(39)36-19-7-3-6-18(13-19)31(32,33)34/h3-14,22-24H,2,15H2,1H3,(H,36,39)/t22-,23?,24?/m0/s1 |
| InChIKey | QEDRFRHCLPMBLP-BOMBAVFCSA-N |
| XLogP | 4.93 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|