C33H28N4O8S2 — CID 18862455
ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862455) has the molecular formula C33H28N4O8S2 and a molecular weight of 672.74 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862455 |
| Molecular Formula | C33H28N4O8S2 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccnc2)[C@H]2C(=O)N(c4ccc(C(=O)OCC)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C33H28N4O8S2/c1-3-44-31(41)18-7-11-21(12-8-18)35-23(38)17-36-30-27(47-33(36)43)24(20-6-5-15-34-16-20)25-26(46-30)29(40)37(28(25)39)22-13-9-19(10-14-22)32(42)45-4-2/h5-16,24-26H,3-4,17H2,1-2H3,(H,35,38)/t24-,25+,26-/m0/s1 |
| InChIKey | FUHJVUMHDKZNQV-NXCFDTQHSA-N |
| XLogP | 4.09 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|