C29H29ClN4O4S2 — CID 43847166
11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43847166) has the molecular formula C29H29ClN4O4S2 and a molecular weight of 597.16 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43847166 |
| Molecular Formula | C29H29ClN4O4S2 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CN(C)c1ccc(C2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C29H29ClN4O4S2/c1-31(2)19-10-6-17(7-11-19)22-23-24(27(37)34(26(23)36)20-12-8-18(30)9-13-20)39-28-25(22)40-29(38)33(28)16-21(35)32-14-4-3-5-15-32/h6-13,22-24H,3-5,14-16H2,1-2H3 |
| InChIKey | DAGKZNXQARHWJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|