C27H24ClN3O5S2 — CID 21227535
11-(4-chlorophenyl)-8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 21227535) has the molecular formula C27H24ClN3O5S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 11-(4-chlorophenyl)-8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 21227535 |
| Molecular Formula | C27H24ClN3O5S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 11-(4-chlorophenyl)-8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccccc1O)C1C(=O)N(c3ccc(Cl)cc3)C(=O)C1S2)N1CCCCC1 |
| InChI | InChI=1S/C27H24ClN3O5S2/c28-15-8-10-16(11-9-15)31-24(34)21-20(17-6-2-3-7-18(17)32)23-26(37-22(21)25(31)35)30(27(36)38-23)14-19(33)29-12-4-1-5-13-29/h2-3,6-11,20-22,32H,1,4-5,12-14H2 |
| InChIKey | YACOAHREWMSXOG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|