C28H27ClN4O5S2 — CID 16634865
(8S)-11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16634865) has the molecular formula C28H27ClN4O5S2 and a molecular weight of 599.13 g/mol. Its IUPAC name is (8S)-11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16634865 |
| Molecular Formula | C28H27ClN4O5S2 |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | (8S)-11-(4-chlorophenyl)-8-[4-(dimethylamino)phenyl]-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CN(C)c1ccc([C@H]2c3sc(=O)n(CC(=O)N4CCOCC4)c3SC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C28H27ClN4O5S2/c1-30(2)18-7-3-16(4-8-18)21-22-23(26(36)33(25(22)35)19-9-5-17(29)6-10-19)39-27-24(21)40-28(37)32(27)15-20(34)31-11-13-38-14-12-31/h3-10,21-23H,11-15H2,1-2H3/t21-,22?,23?/m1/s1 |
| InChIKey | WHTBBFXCQPBUCK-DDRJZQQSSA-N |
| XLogP | 3.28 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|