C19H19N3O4S3 — CID 18862962
(1S,8R,9S)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 18862962) has the molecular formula C19H19N3O4S3 and a molecular weight of 449.58 g/mol. Its IUPAC name is (1S,8R,9S)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1S,8R,9S)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 18862962 |
| Molecular Formula | C19H19N3O4S3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (1S,8R,9S)-4-(2-oxo-2-piperidin-1-ylethyl)-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1NC(=O)[C@H]2Sc3c(sc(=O)n3CC(=O)N3CCCCC3)[C@@H](c3cccs3)[C@@H]12 |
| InChI | InChI=1S/C19H19N3O4S3/c23-11(21-6-2-1-3-7-21)9-22-18-15(29-19(22)26)12(10-5-4-8-27-10)13-14(28-18)17(25)20-16(13)24/h4-5,8,12-14H,1-3,6-7,9H2,(H,20,24,25)/t12-,13+,14-/m0/s1 |
| InChIKey | GNXIWFLJHYRKLX-MJBXVCDLSA-N |
| XLogP | 1.86 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|