C24H27N3O5S2 — CID 43846692
(8R)-8-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43846692) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is (8R)-8-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8R)-8-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43846692 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (8R)-8-(4-tert-butylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CC(C)(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCOCC4)c3SC3C(=O)NC(=O)C32)cc1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-24(2,3)14-6-4-13(5-7-14)16-17-18(21(30)25-20(17)29)33-22-19(16)34-23(31)27(22)12-15(28)26-8-10-32-11-9-26/h4-7,16-18H,8-12H2,1-3H3,(H,25,29,30)/t16-,17?,18?/m0/s1 |
| InChIKey | HMBPQDABNOYYKJ-AOCRQIFASA-N |
| XLogP | 1.94 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|