C26H30N4O5S2 — CID 21227080
8-(4-tert-butylphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 21227080) has the molecular formula C26H30N4O5S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | 8-(4-tert-butylphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 21227080 |
| Molecular Formula | C26H30N4O5S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 8-(4-tert-butylphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(C(N)=O)C(=O)C32)cc1 |
| InChI | InChI=1S/C26H30N4O5S2/c1-26(2,3)15-9-7-14(8-10-15)17-18-19(22(33)30(21(18)32)24(27)34)36-23-20(17)37-25(35)29(23)13-16(31)28-11-5-4-6-12-28/h7-10,17-19H,4-6,11-13H2,1-3H3,(H2,27,34) |
| InChIKey | WERFTRLHGITKFZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|