C32H32F3N3O4S2 — CID 103596739
(8S)-8-(4-tert-butylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 103596739) has the molecular formula C32H32F3N3O4S2 and a molecular weight of 643.75 g/mol. Its IUPAC name is (8S)-8-(4-tert-butylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-(4-tert-butylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 103596739 |
| Molecular Formula | C32H32F3N3O4S2 |
| Molecular Weight | 643.75 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | (8S)-8-(4-tert-butylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CC(C)(C)c1ccc([C@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1 |
| InChI | InChI=1S/C32H32F3N3O4S2/c1-31(2,3)19-12-10-18(11-13-19)23-24-25(28(41)38(27(24)40)21-9-7-8-20(16-21)32(33,34)35)43-29-26(23)44-30(42)37(29)17-22(39)36-14-5-4-6-15-36/h7-13,16,23-25H,4-6,14-15,17H2,1-3H3/t23-,24?,25?/m1/s1 |
| InChIKey | UGCIOMYXWGTIFL-CZUALIRWSA-N |
| XLogP | 6.03 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|