C30H28F3N3O6S2 — CID 43846437
(8R)-8-(3,4-dimethoxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43846437) has the molecular formula C30H28F3N3O6S2 and a molecular weight of 647.70 g/mol. Its IUPAC name is (8R)-8-(3,4-dimethoxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8R)-8-(3,4-dimethoxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43846437 |
| Molecular Formula | C30H28F3N3O6S2 |
| Molecular Weight | 647.70 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | (8R)-8-(3,4-dimethoxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C30H28F3N3O6S2/c1-41-19-10-9-16(13-20(19)42-2)22-23-24(27(39)36(26(23)38)18-8-6-7-17(14-18)30(31,32)33)43-28-25(22)44-29(40)35(28)15-21(37)34-11-4-3-5-12-34/h6-10,13-14,22-24H,3-5,11-12,15H2,1-2H3/t22-,23?,24?/m0/s1 |
| InChIKey | BVUYDRNSITUWCE-BOMBAVFCSA-N |
| XLogP | 4.75 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|