C31H24F3N3O6S2 — CID 16635765
2-[(8S)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 16635765) has the molecular formula C31H24F3N3O6S2 and a molecular weight of 655.68 g/mol. Its IUPAC name is 2-[(8S)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(8S)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16635765 |
| Molecular Formula | C31H24F3N3O6S2 |
| Molecular Weight | 655.68 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | 2-[(8S)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4cccc(C(F)(F)F)c4)c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C31H24F3N3O6S2/c1-42-20-12-11-16(13-21(20)43-2)23-24-25(28(40)37(27(24)39)19-9-4-3-5-10-19)44-29-26(23)45-30(41)36(29)15-22(38)35-18-8-6-7-17(14-18)31(32,33)34/h3-14,23-25H,15H2,1-2H3,(H,35,38)/t23-,24?,25?/m1/s1 |
| InChIKey | YIMOTNSQAXVXMT-CZUALIRWSA-N |
| XLogP | 5.38 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|