C31H27N3O6S2 — CID 16558087
2-[8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 16558087) has the molecular formula C31H27N3O6S2 and a molecular weight of 601.71 g/mol. Its IUPAC name is 2-[8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16558087 |
| Molecular Formula | C31H27N3O6S2 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 2-[8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccccc4)c3SC3C(=O)N(c4ccc(C)cc4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C31H27N3O6S2/c1-17-9-12-20(13-10-17)34-28(36)25-24(18-11-14-21(39-2)22(15-18)40-3)27-30(41-26(25)29(34)37)33(31(38)42-27)16-23(35)32-19-7-5-4-6-8-19/h4-15,24-26H,16H2,1-3H3,(H,32,35) |
| InChIKey | JTGGZQWNHOJXPK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|