C30H26N4O8S3 — CID 43848233
2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43848233) has the molecular formula C30H26N4O8S3 and a molecular weight of 666.76 g/mol. Its IUPAC name is 2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43848233 |
| Molecular Formula | C30H26N4O8S3 |
| Molecular Weight | 666.76 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | 2-[8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C30H26N4O8S3/c1-41-20-13-8-16(14-21(20)42-2)23-24-25(28(37)34(27(24)36)18-6-4-3-5-7-18)43-29-26(23)44-30(38)33(29)15-22(35)32-17-9-11-19(12-10-17)45(31,39)40/h3-14,23-25H,15H2,1-2H3,(H,32,35)(H2,31,39,40) |
| InChIKey | BYJZPFNEXLSZSC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|