C29H23N5O9S3 — CID 43847536
2-[8-(2-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43847536) has the molecular formula C29H23N5O9S3 and a molecular weight of 681.73 g/mol. Its IUPAC name is 2-[8-(2-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[8-(2-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43847536 |
| Molecular Formula | C29H23N5O9S3 |
| Molecular Weight | 681.73 g/mol |
| Exact Mass | 681.07 |
| IUPAC Name | 2-[8-(2-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccccc1C1c2sc(=O)n(CC(=O)Nc3ccc(S(N)(=O)=O)cc3)c2SC2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C21 |
| InChI | InChI=1S/C29H23N5O9S3/c1-43-20-5-3-2-4-19(20)22-23-24(27(37)33(26(23)36)16-8-10-17(11-9-16)34(39)40)44-28-25(22)45-29(38)32(28)14-21(35)31-15-6-12-18(13-7-15)46(30,41)42/h2-13,22-24H,14H2,1H3,(H,31,35)(H2,30,41,42) |
| InChIKey | IRZWIZLUECBKIJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 201.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|