C30H21F3N4O8S2 — CID 21227596
2-[8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 21227596) has the molecular formula C30H21F3N4O8S2 and a molecular weight of 686.65 g/mol. Its IUPAC name is 2-[8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21227596 |
| Molecular Formula | C30H21F3N4O8S2 |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 686.08 |
| IUPAC Name | 2-[8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(C2c3sc(=O)n(CC(=O)Nc4cccc(C(F)(F)F)c4)c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C30H21F3N4O8S2/c1-45-20-11-14(5-10-19(20)38)22-23-24(27(41)36(26(23)40)17-6-8-18(9-7-17)37(43)44)46-28-25(22)47-29(42)35(28)13-21(39)34-16-4-2-3-15(12-16)30(31,32)33/h2-12,22-24,38H,13H2,1H3,(H,34,39) |
| InChIKey | OSNDZILGDRCQNU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|