C30H24N4O8S2 — CID 18862534
2-[(1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 18862534) has the molecular formula C30H24N4O8S2 and a molecular weight of 632.68 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18862534 |
| Molecular Formula | C30H24N4O8S2 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | 2-[(1S,8R,9S)-8-(4-hydroxy-3-methoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(C)cc4)c3S[C@@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@H]23)ccc1O |
| InChI | InChI=1S/C30H24N4O8S2/c1-15-3-6-17(7-4-15)31-22(36)14-32-29-26(44-30(32)39)23(16-5-12-20(35)21(13-16)42-2)24-25(43-29)28(38)33(27(24)37)18-8-10-19(11-9-18)34(40)41/h3-13,23-25,35H,14H2,1-2H3,(H,31,36)/t23-,24+,25-/m0/s1 |
| InChIKey | VCVZZJDPWMJJRK-GVAUOCQISA-N |
| XLogP | 4.28 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|