C31H26N4O8S2 — CID 19248484
2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 19248484) has the molecular formula C31H26N4O8S2 and a molecular weight of 646.70 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19248484 |
| Molecular Formula | C31H26N4O8S2 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.12 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccccc4C)c3S[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]23)cc1OC |
| InChI | InChI=1S/C31H26N4O8S2/c1-16-6-4-5-7-20(16)32-23(36)15-33-30-27(45-31(33)39)24(17-8-13-21(42-2)22(14-17)43-3)25-26(44-30)29(38)34(28(25)37)18-9-11-19(12-10-18)35(40)41/h4-14,24-26H,15H2,1-3H3,(H,32,36)/t24-,25-,26+/m0/s1 |
| InChIKey | KAVJJUQBVGCURM-KKUQBAQOSA-N |
| XLogP | 4.58 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|