C29H21ClN4O6S2 — CID 43846262
2-[(8R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 43846262) has the molecular formula C29H21ClN4O6S2 and a molecular weight of 621.10 g/mol. Its IUPAC name is 2-[(8R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43846262 |
| Molecular Formula | C29H21ClN4O6S2 |
| Molecular Weight | 621.10 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | 2-[(8R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(Cl)cc2)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C29H21ClN4O6S2/c1-15-2-8-18(9-3-15)31-21(35)14-32-28-25(42-29(32)38)22(16-4-6-17(30)7-5-16)23-24(41-28)27(37)33(26(23)36)19-10-12-20(13-11-19)34(39)40/h2-13,22-24H,14H2,1H3,(H,31,35)/t22-,23?,24?/m0/s1 |
| InChIKey | ONIDBXTUMNKLHQ-BOMBAVFCSA-N |
| XLogP | 5.21 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.10 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|