C28H17Cl3N4O6S2 — CID 19248548
2-[(1R,8R,9R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 19248548) has the molecular formula C28H17Cl3N4O6S2 and a molecular weight of 675.96 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19248548 |
| Molecular Formula | C28H17Cl3N4O6S2 |
| Molecular Weight | 675.96 g/mol |
| Exact Mass | 673.97 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(4-chlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccc(Cl)cc1)[C@@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]1S2)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H17Cl3N4O6S2/c29-14-3-1-13(2-4-14)21-22-23(26(38)34(25(22)37)16-6-8-17(9-7-16)35(40)41)42-27-24(21)43-28(39)33(27)12-20(36)32-15-5-10-18(30)19(31)11-15/h1-11,21-23H,12H2,(H,32,36)/t21-,22-,23+/m0/s1 |
| InChIKey | SFMZGCSXKRHWCO-RJGXRXQPSA-N |
| XLogP | 6.21 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.96 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|