C27H18ClN5O6S2 — CID 43846249
N-(4-chlorophenyl)-2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 43846249) has the molecular formula C27H18ClN5O6S2 and a molecular weight of 608.06 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 43846249 |
| Molecular Formula | C27H18ClN5O6S2 |
| Molecular Weight | 608.06 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccnc1)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C1S2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H18ClN5O6S2/c28-15-3-5-16(6-4-15)30-19(34)13-31-26-23(41-27(31)37)20(14-2-1-11-29-12-14)21-22(40-26)25(36)32(24(21)35)17-7-9-18(10-8-17)33(38)39/h1-12,20-22H,13H2,(H,30,34)/t20-,21?,22?/m0/s1 |
| InChIKey | SDPNUXDNUCNJLD-HWELCPFYSA-N |
| XLogP | 4.30 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|