C27H19ClN4O5S2 — CID 16634893
2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16634893) has the molecular formula C27H19ClN4O5S2 and a molecular weight of 579.06 g/mol. Its IUPAC name is 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16634893 |
| Molecular Formula | C27H19ClN4O5S2 |
| Molecular Weight | 579.06 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccnc1)C1C(=O)N(c3ccc(Cl)cc3)C(=O)C1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C27H19ClN4O5S2/c28-15-3-7-17(8-4-15)32-24(35)21-20(14-2-1-11-29-12-14)23-26(38-22(21)25(32)36)31(27(37)39-23)13-19(34)30-16-5-9-18(33)10-6-16/h1-12,20-22,33H,13H2,(H,30,34)/t20-,21?,22?/m1/s1 |
| InChIKey | KMKDBIVWACMPBC-ITAUSPCMSA-N |
| XLogP | 4.10 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.06 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|