C27H17BrCl2N4O4S2 — CID 16634793
2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 16634793) has the molecular formula C27H17BrCl2N4O4S2 and a molecular weight of 676.40 g/mol. Its IUPAC name is 2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 16634793 |
| Molecular Formula | C27H17BrCl2N4O4S2 |
| Molecular Weight | 676.40 g/mol |
| Exact Mass | 673.93 |
| IUPAC Name | 2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccnc1)C1C(=O)N(c3ccc(Br)cc3)C(=O)C1S2)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H17BrCl2N4O4S2/c28-14-3-6-16(7-4-14)34-24(36)21-20(13-2-1-9-31-11-13)23-26(39-22(21)25(34)37)33(27(38)40-23)12-19(35)32-15-5-8-17(29)18(30)10-15/h1-11,20-22H,12H2,(H,32,35)/t20-,21?,22?/m1/s1 |
| InChIKey | HRXLZURDIFRFPN-ITAUSPCMSA-N |
| XLogP | 5.81 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|