C31H24F3N3O6S2 — CID 21227621
2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 21227621) has the molecular formula C31H24F3N3O6S2 and a molecular weight of 655.68 g/mol. Its IUPAC name is 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 21227621 |
| Molecular Formula | C31H24F3N3O6S2 |
| Molecular Weight | 655.68 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | CCOc1cc(C2c3sc(=O)n(CC(=O)Nc4ccccc4)c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C31H24F3N3O6S2/c1-2-43-21-13-16(11-12-20(21)38)23-24-25(28(41)37(27(24)40)19-10-6-7-17(14-19)31(32,33)34)44-29-26(23)45-30(42)36(29)15-22(39)35-18-8-4-3-5-9-18/h3-14,23-25,38H,2,15H2,1H3,(H,35,39) |
| InChIKey | KSOHURRPBXMRIO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|