C32H26F3N3O7S2 — CID 21226988
2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 21226988) has the molecular formula C32H26F3N3O7S2 and a molecular weight of 685.70 g/mol. Its IUPAC name is 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 21226988 |
| Molecular Formula | C32H26F3N3O7S2 |
| Molecular Weight | 685.70 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | 2-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(C2c3sc(=O)n(CC(=O)Nc4ccc(OC)cc4)c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C32H26F3N3O7S2/c1-3-45-22-13-16(7-12-21(22)39)24-25-26(29(42)38(28(25)41)19-6-4-5-17(14-19)32(33,34)35)46-30-27(24)47-31(43)37(30)15-23(40)36-18-8-10-20(44-2)11-9-18/h4-14,24-26,39H,3,15H2,1-2H3,(H,36,40) |
| InChIKey | LTOBZXNVYYIQGM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|