C28H27N3O7S2 — CID 43848263
8-(3,4-dimethoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43848263) has the molecular formula C28H27N3O7S2 and a molecular weight of 581.67 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(3,4-dimethoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43848263 |
| Molecular Formula | C28H27N3O7S2 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)N4CCOCC4)c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C28H27N3O7S2/c1-36-18-9-8-16(14-19(18)37-2)21-22-23(26(34)31(25(22)33)17-6-4-3-5-7-17)39-27-24(21)40-28(35)30(27)15-20(32)29-10-12-38-13-11-29/h3-9,14,21-23H,10-13,15H2,1-2H3 |
| InChIKey | DALCYJJBIBWTEB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|