C23H24N4O6S2 — CID 21227078
8-(4-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 21227078) has the molecular formula C23H24N4O6S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | 8-(4-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 21227078 |
| Molecular Formula | C23H24N4O6S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 8-(4-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | COc1ccc(C2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(C(N)=O)C(=O)C32)cc1 |
| InChI | InChI=1S/C23H24N4O6S2/c1-33-13-7-5-12(6-8-13)15-16-17(20(30)27(19(16)29)22(24)31)34-21-18(15)35-23(32)26(21)11-14(28)25-9-3-2-4-10-25/h5-8,15-17H,2-4,9-11H2,1H3,(H2,24,31) |
| InChIKey | RYRBDVIXCYWPKD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|