C25H22N4O6S2 — CID 43846498
(8R)-8-(4-methoxyphenyl)-4-[2-(4-methylanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 43846498) has the molecular formula C25H22N4O6S2 and a molecular weight of 538.61 g/mol. Its IUPAC name is (8R)-8-(4-methoxyphenyl)-4-[2-(4-methylanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (8R)-8-(4-methoxyphenyl)-4-[2-(4-methylanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 43846498 |
| Molecular Formula | C25H22N4O6S2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | (8R)-8-(4-methoxyphenyl)-4-[2-(4-methylanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(C)cc4)c3SC3C(=O)N(C(N)=O)C(=O)C32)cc1 |
| InChI | InChI=1S/C25H22N4O6S2/c1-12-3-7-14(8-4-12)27-16(30)11-28-23-20(37-25(28)34)17(13-5-9-15(35-2)10-6-13)18-19(36-23)22(32)29(21(18)31)24(26)33/h3-10,17-19H,11H2,1-2H3,(H2,26,33)(H,27,30)/t17-,18?,19?/m0/s1 |
| InChIKey | YFQXDIFBQPGTSC-VIQWUECVSA-N |
| XLogP | 2.54 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|