C25H30N2O3S2 — CID 19250015
(1S,2R,9R,10S,11S)-9-(4-methoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 19250015) has the molecular formula C25H30N2O3S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (1S,2R,9R,10S,11S)-9-(4-methoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2R,9R,10S,11S)-9-(4-methoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 19250015 |
| Molecular Formula | C25H30N2O3S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (1S,2R,9R,10S,11S)-9-(4-methoxyphenyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3S[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]23)cc1 |
| InChI | InChI=1S/C25H30N2O3S2/c1-30-18-9-7-15(8-10-18)20-21-16-5-6-17(13-16)22(21)31-24-23(20)32-25(29)27(24)14-19(28)26-11-3-2-4-12-26/h7-10,16-17,20-22H,2-6,11-14H2,1H3/t16-,17-,20-,21-,22+/m0/s1 |
| InChIKey | OQGQMEHVNZNBFO-BXLRBYEISA-N |
| XLogP | 4.58 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|