C24H28N2O2S2 — CID 19250013
(1S,2R,9R,10S,11S)-5-(2-oxo-2-piperidin-1-ylethyl)-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 19250013) has the molecular formula C24H28N2O2S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is (1S,2R,9R,10S,11S)-5-(2-oxo-2-piperidin-1-ylethyl)-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2R,9R,10S,11S)-5-(2-oxo-2-piperidin-1-ylethyl)-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 19250013 |
| Molecular Formula | C24H28N2O2S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (1S,2R,9R,10S,11S)-5-(2-oxo-2-piperidin-1-ylethyl)-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1S2)N1CCCCC1 |
| InChI | InChI=1S/C24H28N2O2S2/c27-18(25-11-5-2-6-12-25)14-26-23-22(30-24(26)28)19(15-7-3-1-4-8-15)20-16-9-10-17(13-16)21(20)29-23/h1,3-4,7-8,16-17,19-21H,2,5-6,9-14H2/t16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | MDOCHRWQYVMVNY-JZTRKIHISA-N |
| XLogP | 4.57 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|