C25H23ClN2O2S2 — CID 19249923
N-(4-chlorophenyl)-2-[(1S,2R,9R,10S,11S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetamide (PubChem CID 19249923) has the molecular formula C25H23ClN2O2S2 and a molecular weight of 483.06 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1S,2R,9R,10S,11S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1S,2R,9R,10S,11S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetamide |
|---|---|
| PubChem CID | 19249923 |
| Molecular Formula | C25H23ClN2O2S2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1S,2R,9R,10S,11S)-6-oxo-9-phenyl-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1S2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23ClN2O2S2/c26-17-8-10-18(11-9-17)27-19(29)13-28-24-23(32-25(28)30)20(14-4-2-1-3-5-14)21-15-6-7-16(12-15)22(21)31-24/h1-5,8-11,15-16,20-22H,6-7,12-13H2,(H,27,29)/t15-,16-,20-,21-,22+/m0/s1 |
| InChIKey | RMYSGUFSULIQBK-UCEGJLSESA-N |
| XLogP | 5.85 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|