C26H25ClN4O2S3 — CID 94855681
1-[[2-[(1S,2S,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]-3-phenylthiourea (PubChem CID 94855681) has the molecular formula C26H25ClN4O2S3 and a molecular weight of 557.17 g/mol. Its IUPAC name is 1-[[2-[(1S,2S,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[(1S,2S,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 94855681 |
| Molecular Formula | C26H25ClN4O2S3 |
| Molecular Weight | 557.17 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 1-[[2-[(1S,2S,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetyl]amino]-3-phenylthiourea |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccc(Cl)cc1)[C@H]1[C@@H]3CC[C@@H](C3)[C@@H]1S2)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C26H25ClN4O2S3/c27-17-10-8-14(9-11-17)20-21-15-6-7-16(12-15)22(21)35-24-23(20)36-26(33)31(24)13-19(32)29-30-25(34)28-18-4-2-1-3-5-18/h1-5,8-11,15-16,20-22H,6-7,12-13H2,(H,29,32)(H2,28,30,34)/t15-,16+,20-,21-,22+/m1/s1 |
| InChIKey | QEBFEUMRSIGSBS-LLAJYAIDSA-N |
| XLogP | 5.23 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|