C19H20ClN3O2S2 — CID 98170821
2-[(1R,2R,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetohydrazide (PubChem CID 98170821) has the molecular formula C19H20ClN3O2S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is 2-[(1R,2R,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetohydrazide.
| Compound Name | 2-[(1R,2R,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetohydrazide |
|---|---|
| PubChem CID | 98170821 |
| Molecular Formula | C19H20ClN3O2S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[(1R,2R,9S,10R,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]acetohydrazide |
| SMILES | NNC(=O)Cn1c2c(sc1=O)[C@H](c1ccc(Cl)cc1)[C@H]1[C@@H]3CC[C@H](C3)[C@H]1S2 |
| InChI | InChI=1S/C19H20ClN3O2S2/c20-12-5-3-9(4-6-12)14-15-10-1-2-11(7-10)16(15)26-18-17(14)27-19(25)23(18)8-13(24)22-21/h3-6,10-11,14-16H,1-2,7-8,21H2,(H,22,24)/t10-,11-,14-,15-,16-/m1/s1 |
| InChIKey | VUBVNWRXPHTIHJ-JERLVFOGSA-N |
| XLogP | 3.21 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|