C26H25ClN2O2S2 — CID 124769065
2-[(1S,2R,9S,10R,11S)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methylphenyl)acetamide (PubChem CID 124769065) has the molecular formula C26H25ClN2O2S2 and a molecular weight of 497.09 g/mol. Its IUPAC name is 2-[(1S,2R,9S,10R,11S)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(1S,2R,9S,10R,11S)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 124769065 |
| Molecular Formula | C26H25ClN2O2S2 |
| Molecular Weight | 497.09 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-[(1S,2R,9S,10R,11S)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@H](c2ccc(Cl)cc2)[C@H]2[C@H]4CC[C@@H](C4)[C@H]2S3)cc1 |
| InChI | InChI=1S/C26H25ClN2O2S2/c1-14-2-10-19(11-3-14)28-20(30)13-29-25-24(33-26(29)31)21(15-6-8-18(27)9-7-15)22-16-4-5-17(12-16)23(22)32-25/h2-3,6-11,16-17,21-23H,4-5,12-13H2,1H3,(H,28,30)/t16-,17-,21+,22+,23+/m0/s1 |
| InChIKey | DPTHAGGFFIWJGR-FIVLCTCKSA-N |
| XLogP | 6.16 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.09 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|